[[N-(cinnamylideneamino)carbamimidoyl]amino]-hydroxy-oxo-azanium structure
|
Common Name | [[N-(cinnamylideneamino)carbamimidoyl]amino]-hydroxy-oxo-azanium | ||
|---|---|---|---|---|
| CAS Number | 5347-91-1 | Molecular Weight | 233.22700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[(3-phenyl-2-propenylidene)amino]-3-nitroguanidine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H11N5O2 |
|---|---|
| Molecular Weight | 233.22700 |
| Exact Mass | 233.09100 |
| PSA | 106.09000 |
| LogP | 2.39600 |
| InChIKey | CNFDGIYCPXYRQX-HCFISPQYSA-N |
| SMILES | NC(=NN=CC=Cc1ccccc1)N[N+](=O)[O-] |
|
~%
[[N-(cinnamylid... CAS#:5347-91-1 |
| Literature: Whitmore; Revukas; Smith Journal of the American Chemical Society, 1935 , vol. 57, p. 706 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N'-nitro-N-cinnamylidenamino-guanidine |