Laricitrin structure
|
Common Name | Laricitrin | ||
|---|---|---|---|---|
| CAS Number | 53472-37-0 | Molecular Weight | 332.26200 | |
| Density | 1.73g/cm3 | Boiling Point | 667.4ºC at 760 mmHg | |
| Molecular Formula | C16H12O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.6ºC | |
| Name | 2-(3,4-dihydroxy-5-methoxyphenyl)-3,5,7-trihydroxychromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.73g/cm3 |
|---|---|
| Boiling Point | 667.4ºC at 760 mmHg |
| Molecular Formula | C16H12O8 |
| Molecular Weight | 332.26200 |
| Flash Point | 252.6ºC |
| Exact Mass | 332.05300 |
| PSA | 140.59000 |
| LogP | 1.99660 |
| Index of Refraction | 1.772 |
| InChIKey | CFYMYCCYMJIYAB-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2O)cc(O)c1O |
| HS Code | 2914509090 |
|---|
|
~%
Laricitrin CAS#:53472-37-0 |
| Literature: Kim, Bong-Gyu; Lee, Youngshim; Hur, Hor-Gil; Lim, Yoongho; Ahn, Joong-Hoon Phytochemistry, 2006 , vol. 67, # 4 p. 387 - 394 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-(3,4-dihydroxy-5-methoxy-phenyl)-3,5,7-trihydroxy-chromen-4-one |
| Myricetin-3'-methylether |
| 3,4',5,5',7-Pentahydroxy-3'-methoxyflavone |
| 3'-O-Methylmyricetin |
| myricetin-5'-O-methyl ether |
| Laricitrin |