octyl 2-[2-[2-(1-octoxycarbonylethoxycarbonyloxy)ethoxy]ethoxycarbonyloxy]propanoate structure
|
Common Name | octyl 2-[2-[2-(1-octoxycarbonylethoxycarbonyloxy)ethoxy]ethoxycarbonyloxy]propanoate | ||
|---|---|---|---|---|
| CAS Number | 5348-55-0 | Molecular Weight | 562.69000 | |
| Density | 1.072g/cm3 | Boiling Point | 593.8ºC at 760 mmHg | |
| Molecular Formula | C28H50O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244ºC | |
| Name | octyl 2-[2-[2-(1-octoxy-1-oxopropan-2-yl)oxycarbonyloxyethoxy]ethoxycarbonyloxy]propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.072g/cm3 |
|---|---|
| Boiling Point | 593.8ºC at 760 mmHg |
| Molecular Formula | C28H50O11 |
| Molecular Weight | 562.69000 |
| Flash Point | 244ºC |
| Exact Mass | 562.33500 |
| PSA | 132.89000 |
| LogP | 5.89380 |
| Index of Refraction | 1.461 |
| InChIKey | SITNPSJMUSBRBF-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC(=O)C(C)OC(=O)OCCOCCOC(=O)OC(C)C(=O)OCCCCCCCC |
| HS Code | 2918990090 |
|---|
|
~%
octyl 2-[2-[2-(... CAS#:5348-55-0 |
| Literature: Rehberg; Dixon; Fisher Journal of Organic Chemistry, 1949 , vol. 14, p. 594,600 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| dioctyl 2,14-dimethyl-4,12-dioxo-3,5,8,11,13-pentaoxapentadecane-1,15-dioate |