propan-2-yl 2-[2-[2-(1-propan-2-yloxycarbonylethoxycarbonyloxy)ethoxy]ethoxycarbonyloxy]propanoate structure
|
Common Name | propan-2-yl 2-[2-[2-(1-propan-2-yloxycarbonylethoxycarbonyloxy)ethoxy]ethoxycarbonyloxy]propanoate | ||
|---|---|---|---|---|
| CAS Number | 5349-69-9 | Molecular Weight | 422.42400 | |
| Density | 1.172g/cm3 | Boiling Point | 469.2ºC at 760 mmHg | |
| Molecular Formula | C18H30O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.5ºC | |
| Name | propan-2-yl 2-[2-[2-(1-oxo-1-propan-2-yloxypropan-2-yl)oxycarbonyloxyethoxy]ethoxycarbonyloxy]propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.172g/cm3 |
|---|---|
| Boiling Point | 469.2ºC at 760 mmHg |
| Molecular Formula | C18H30O11 |
| Molecular Weight | 422.42400 |
| Flash Point | 200.5ºC |
| Exact Mass | 422.17900 |
| PSA | 132.89000 |
| LogP | 1.98960 |
| Index of Refraction | 1.454 |
| InChIKey | XHUYWFDCVCOMBF-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C(C)OC(=O)OCCOCCOC(=O)OC(C)C(=O)OC(C)C |
| HS Code | 2918990090 |
|---|
|
~%
propan-2-yl 2-[... CAS#:5349-69-9 |
| Literature: Rehberg; Dixon; Fisher Journal of Organic Chemistry, 1949 , vol. 14, p. 594,600 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| dipropan-2-yl 2,14-dimethyl-4,12-dioxo-3,5,8,11,13-pentaoxapentadecane-1,15-dioate |