(2Z)-2-hydroxyimino-6-methoxy-4,4-dimethyl-tetralin-1-one structure
|
Common Name | (2Z)-2-hydroxyimino-6-methoxy-4,4-dimethyl-tetralin-1-one | ||
|---|---|---|---|---|
| CAS Number | 53503-63-2 | Molecular Weight | 233.26300 | |
| Density | 1.2g/cm3 | Boiling Point | 404.3ºC at 760 mmHg | |
| Molecular Formula | C13H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.3ºC | |
| Name | (2E)-2-hydroxyimino-6-methoxy-4,4-dimethyl-3H-naphthalen-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 404.3ºC at 760 mmHg |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.26300 |
| Flash Point | 198.3ºC |
| Exact Mass | 233.10500 |
| PSA | 58.89000 |
| LogP | 2.38940 |
| Index of Refraction | 1.57 |
| InChIKey | PQIFLSJMRMFNBF-KAMYIIQDSA-N |
| SMILES | COc1ccc2c(c1)C(C)(C)CC(=NO)C2=O |
|
~%
(2Z)-2-hydroxyi... CAS#:53503-63-2 |
| Literature: Sawa; Kato; Masuda; Hori; Fujimura Chemical and Pharmaceutical Bulletin, 1975 , vol. 23, # 9 p. 1917 - 1927 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3,4-dihydro-6-methoxy-4,4-dimethyl-1,2-naphthalenedione,2-oxime |