3-BROMO-4-OXO-4-P-TOLYL-BUTYRIC ACID structure
|
Common Name | 3-BROMO-4-OXO-4-P-TOLYL-BUTYRIC ACID | ||
|---|---|---|---|---|
| CAS Number | 53515-23-4 | Molecular Weight | 271.10700 | |
| Density | N/A | Boiling Point | 390.6ºC at 760 mmHg | |
| Molecular Formula | C11H11BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190ºC | |
| Name | 3-Bromo-4-(4-methylphenyl)-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 390.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C11H11BrO3 |
| Molecular Weight | 271.10700 |
| Flash Point | 190ºC |
| Exact Mass | 269.98900 |
| PSA | 54.37000 |
| LogP | 2.41590 |
| InChIKey | AFLMNHCSODTMON-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)C(Br)CC(=O)O)cc1 |
| HS Code | 2918300090 |
|---|
|
~%
3-BROMO-4-OXO-4... CAS#:53515-23-4 |
| Literature: Pillay, M. Krishna; Banumathi, K. Journal of Chemical Research, Miniprint, 1997 , # 7 p. 1601 - 1614 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 3-Brom-4-oxo-4-p-tolyl-buttersaeure |
| 3-Bromo-4-oxo-4-p-tolyl-butyric acid |