N-butyl-2-nitrobenzamide
Modify Date: 2025-09-21 13:02:09
N-butyl-2-nitrobenzamide structure
|
Common Name | N-butyl-2-nitrobenzamide | ||
|---|---|---|---|---|
| CAS Number | 5352-10-3 | Molecular Weight | 222.24000 | |
| Density | 1.162g/cm3 | Boiling Point | 385.9ºC at 760 mmHg | |
| Molecular Formula | C11H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.2ºC | |
| Name | N-butyl-2-nitrobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.162g/cm3 |
|---|---|
| Boiling Point | 385.9ºC at 760 mmHg |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24000 |
| Flash Point | 187.2ºC |
| Exact Mass | 222.10000 |
| PSA | 78.41000 |
| LogP | 3.22270 |
| Index of Refraction | 1.543 |
| InChIKey | YRNIXNMRAQAEON-UHFFFAOYSA-N |
| SMILES | CCCCNC(=O)c1ccccc1[N+](=O)[O-] |
| HS Code | 2903999090 |
|---|
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-Chlor-2,2-bis-(2-chlorphenyl)-ethylen |
| N-butyl(2-nitrophenyl)carboxamide |