1-(4-methylphenoxy)sulfonyl-3-nitro-benzene structure
|
Common Name | 1-(4-methylphenoxy)sulfonyl-3-nitro-benzene | ||
|---|---|---|---|---|
| CAS Number | 5354-03-0 | Molecular Weight | 293.29500 | |
| Density | 1.388g/cm3 | Boiling Point | 462.7ºC at 760 mmHg | |
| Molecular Formula | C13H11NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.6ºC | |
| Name | (4-methylphenyl) 3-nitrobenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.388g/cm3 |
|---|---|
| Boiling Point | 462.7ºC at 760 mmHg |
| Molecular Formula | C13H11NO5S |
| Molecular Weight | 293.29500 |
| Flash Point | 233.6ºC |
| Exact Mass | 293.03600 |
| PSA | 97.57000 |
| LogP | 4.27490 |
| Index of Refraction | 1.604 |
| InChIKey | DRYHZJMDXFTOHB-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OS(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1 |
|
~%
1-(4-methylphen... CAS#:5354-03-0 |
| Literature: Dannley,R.L. et al. Journal of Organic Chemistry, 1970 , vol. 35, # 9 p. 3076 - 3079 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| p-Methylphenyl-m-nitrobenzolsulfonat |
| 4-methylphenyl 3-nitrobenzenesulfonate |