3,5,8,10-tetrachloro-1,6-pyrenedione structure
|
Common Name | 3,5,8,10-tetrachloro-1,6-pyrenedione | ||
|---|---|---|---|---|
| CAS Number | 5355-83-9 | Molecular Weight | 370.01400 | |
| Density | 1.28g/cm3 | Boiling Point | 497.7ºC at 760mmHg | |
| Molecular Formula | C16H4Cl4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.8ºC | |
| Name | 3,5,8,10-tetrachloropyrene-1,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 497.7ºC at 760mmHg |
| Molecular Formula | C16H4Cl4O2 |
| Molecular Weight | 370.01400 |
| Flash Point | 254.8ºC |
| Exact Mass | 367.89700 |
| PSA | 34.14000 |
| LogP | 5.69860 |
| Index of Refraction | 1.57 |
| InChIKey | DZFGTXSVRDJNIS-UHFFFAOYSA-N |
| SMILES | O=C1C=C(Cl)c2cc(Cl)c3c4c(cc(Cl)c1c24)C(Cl)=CC3=O |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 3,5,8,10-Tetrachlor-pyren-1,6-dion |
| 2,5,7,10-tetrachloropyrene-3,8-quinone |
| 3,5,8,10-tetrachloropyrene-1,6-quinone |
| 3.5.8.10-Tetrachlor-pyren-1.6-chinon |
| 3,5,8,10-TETRACHLORO-1,6-PYRENEDIONE |
| 1,6-Pyrenedione,3,5,8,10-tetrachloro |
| 3,5,8,10-tetrachloro-pyrene-1,6-dione |
| 3.5.8.10-Tetrachlor-pyren-chinon-(1.6) |