3,4,5-Trichlorobiphenyl structure
|
Common Name | 3,4,5-Trichlorobiphenyl | ||
|---|---|---|---|---|
| CAS Number | 53555-66-1 | Molecular Weight | 257.54300 | |
| Density | 1.351g/cm3 | Boiling Point | 353.5ºC at 760mmHg | |
| Molecular Formula | C12H7Cl3 | Melting Point | 63.91°C (estimate) | |
| MSDS | N/A | Flash Point | 244.9ºC | |
| Name | 3,4,5-Trichlorobiphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.351g/cm3 |
|---|---|
| Boiling Point | 353.5ºC at 760mmHg |
| Melting Point | 63.91°C (estimate) |
| Molecular Formula | C12H7Cl3 |
| Molecular Weight | 257.54300 |
| Flash Point | 244.9ºC |
| Exact Mass | 255.96100 |
| LogP | 5.31380 |
| Index of Refraction | 1.603 |
| InChIKey | BSFZSQRJGZHMMV-UHFFFAOYSA-N |
| SMILES | Clc1cc(-c2ccccc2)cc(Cl)c1Cl |
| HS Code | 2903999010 |
|---|
| HS Code | 2903999010 |
|---|---|
| Summary | 2903999010 2,3,3',4,5,6-hexachloro-1,1'-biphenyl。supervision conditions:89(articles on the list of prohibited export goods,articles on the list of prohibited import goods)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:5.5%。general tariff:30.0% |
| 1,2,3-trichloro-5-phenylbenzene |