4-((2,4-Dichlorobenzyl)thio)-6,7-dimethoxycinnoline structure
|
Common Name | 4-((2,4-Dichlorobenzyl)thio)-6,7-dimethoxycinnoline | ||
|---|---|---|---|---|
| CAS Number | 5356-20-7 | Molecular Weight | 381.27600 | |
| Density | 1.43g/cm3 | Boiling Point | 538.1ºC at 760 mmHg | |
| Molecular Formula | C17H14Cl2N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.2ºC | |
| Name | 4-[(2,4-dichlorophenyl)methylsulfanyl]-6,7-dimethoxycinnoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 538.1ºC at 760 mmHg |
| Molecular Formula | C17H14Cl2N2O2S |
| Molecular Weight | 381.27600 |
| Flash Point | 279.2ºC |
| Exact Mass | 380.01500 |
| PSA | 69.54000 |
| LogP | 5.24610 |
| Index of Refraction | 1.672 |
| InChIKey | SIPXDXODSCFWAY-UHFFFAOYSA-N |
| SMILES | COc1cc2nncc(SCc3ccc(Cl)cc3Cl)c2cc1OC |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6,7-Dimethoxy-4-(2,4-dichlor-benzylmercapto)-cinnolin |
| 4-(2,4-dichloro-benzylsulfanyl)-6,7-dimethoxy-cinnoline |
| 4-((2,4-Dichlorobenzyl)thio)-6,7-dimethoxycinnoline |