N-(2-oxoindol-3-yl)adamantane-1-carbohydrazide structure
|
Common Name | N-(2-oxoindol-3-yl)adamantane-1-carbohydrazide | ||
|---|---|---|---|---|
| CAS Number | 5356-92-3 | Molecular Weight | 237.37000 | |
| Density | 1.026g/cm3 | Boiling Point | 372ºC at 760 mmHg | |
| Molecular Formula | C12H19NO2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.8ºC | |
| Name | Hydroxymethylphenethyldimethylsilane Carbamate |
|---|
| Density | 1.026g/cm3 |
|---|---|
| Boiling Point | 372ºC at 760 mmHg |
| Molecular Formula | C12H19NO2Si |
| Molecular Weight | 237.37000 |
| Flash Point | 178.8ºC |
| Exact Mass | 237.11900 |
| PSA | 52.32000 |
| LogP | 3.69060 |
| Index of Refraction | 1.503 |
| InChIKey | VGCSJUHUJPEJOZ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(CCc1ccccc1)COC(N)=O |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |