1H-Indene-1,3(2H)-dione,2-[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methylene]- structure
|
Common Name | 1H-Indene-1,3(2H)-dione,2-[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methylene]- | ||
|---|---|---|---|---|
| CAS Number | 53566-09-9 | Molecular Weight | 362.46100 | |
| Density | 1.165g/cm3 | Boiling Point | 493.1ºC at 760mmHg | |
| Molecular Formula | C24H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.1ºC | |
| Name | 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]indene-1,3-dione |
|---|
| Density | 1.165g/cm3 |
|---|---|
| Boiling Point | 493.1ºC at 760mmHg |
| Molecular Formula | C24H26O3 |
| Molecular Weight | 362.46100 |
| Flash Point | 266.1ºC |
| Exact Mass | 362.18800 |
| PSA | 54.37000 |
| LogP | 5.44980 |
| Index of Refraction | 1.61 |
| InChIKey | ILEVUAQYAJZPCR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(C=C2C(=O)c3ccccc3C2=O)cc(C(C)(C)C)c1O |
| HS Code | 2914400090 |
|---|
|
~99%
1H-Indene-1,3(2... CAS#:53566-09-9 |
| Literature: Hori, Hitoshi; Nagasawa, Hideko; Ishibashi, Masaki; Uto, Yoshihiro; Hirata, Akihiko; Saijo, Kouichi; Ohkura, Kazuto; Kirk, Kenneth L; Uehara, Yoshimasa Bioorganic and Medicinal Chemistry, 2002 , vol. 10, # 10 p. 3257 - 3265 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |