1-[(4-chlorophenyl)methoxy]-3-pyridin-2-ylsulfanylpropan-2-ol structure
|
Common Name | 1-[(4-chlorophenyl)methoxy]-3-pyridin-2-ylsulfanylpropan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 5357-23-3 | Molecular Weight | 309.81100 | |
| Density | 1.3g/cm3 | Boiling Point | 480.8ºC at 760 mmHg | |
| Molecular Formula | C15H16ClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.5ºC | |
| Name | 1-[(4-chlorophenyl)methoxy]-3-pyridin-2-ylsulfanylpropan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 480.8ºC at 760 mmHg |
| Molecular Formula | C15H16ClNO2S |
| Molecular Weight | 309.81100 |
| Flash Point | 244.5ºC |
| Exact Mass | 309.05900 |
| PSA | 67.65000 |
| LogP | 3.40480 |
| Index of Refraction | 1.622 |
| InChIKey | DHQVRSQXDBYKJW-UHFFFAOYSA-N |
| SMILES | OC(COCc1ccc(Cl)cc1)CSc1ccccn1 |
|
~%
1-[(4-chlorophe... CAS#:5357-23-3 |
| Literature: Mikhailov,B.M. et al. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1964 , p. 186 - 188 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1964 , p. 199 - 201 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-[(4-chlorophenyl)methoxy]-3-pyridin-2-ylsulfanyl-propan-2-ol |
| (3-Amino-propyl)-dibutylboran |
| (3-Amino-propyl)-dibutylbor |