1-[(4-chlorophenyl)methoxy]-3-pyridin-2-ylsulfanylpropan-2-ol
![1-[(4-chlorophenyl)methoxy]-3-pyridin-2-ylsulfanylpropan-2-ol Structure](https://image.chemsrc.com/caspic/436/5357-23-3.png)
1-[(4-chlorophenyl)methoxy]-3-pyridin-2-ylsulfanylpropan-2-ol structure
|
Common Name | 1-[(4-chlorophenyl)methoxy]-3-pyridin-2-ylsulfanylpropan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 5357-23-3 | Molecular Weight | 309.81100 | |
| Density | 1.3g/cm3 | Boiling Point | 480.8ºC at 760 mmHg | |
| Molecular Formula | C15H16ClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[(4-chlorophenyl)methoxy]-3-pyridin-2-ylsulfanylpropan-2-ol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 480.8ºC at 760 mmHg |
| Molecular Formula | C15H16ClNO2S |
| Molecular Weight | 309.81100 |
| Flash Point | 244.5ºC |
| Exact Mass | 309.05900 |
| PSA | 67.65000 |
| LogP | 3.40480 |
| Index of Refraction | 1.622 |
| InChIKey | DHQVRSQXDBYKJW-UHFFFAOYSA-N |
| SMILES | OC(COCc1ccc(Cl)cc1)CSc1ccccn1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-[(4-chlorophe... CAS#:5357-23-3 |
| Literature: Mikhailov,B.M. et al. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1964 , p. 186 - 188 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1964 , p. 199 - 201 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-[(4-chlorophenyl)methoxy]-3-pyridin-2-ylsulfanyl-propan-2-ol |
| (3-Amino-propyl)-dibutylboran |
| (3-Amino-propyl)-dibutylbor |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 1-[(4-chlorophenyl)methoxy]-3-pyridin-2-ylsulfanylpropan-2-ol? |
| A: Polar surface area (PSA) of 1-[(4-chlorophenyl)methoxy]-3-pyridin-2-ylsulfanylpropan-2-ol is 67.65000. |
| Q: What is the English name of 1-[(4-chlorophenyl)methoxy]-3-pyridin-2-ylsulfanylpropan-2-ol? |
| A: The English name of 1-[(4-chlorophenyl)methoxy]-3-pyridin-2-ylsulfanylpropan-2-ol is 1-[(4-chlorophenyl)methoxy]-3-pyridin-2-ylsulfanylpropan-2-ol. |
| Q: What is the Chinese name of 5357-23-3? |
| A: Chinese name of 5357-23-3 is 5357-23-3. |
| Q: What is the LogP of 1-[(4-chlorophenyl)methoxy]-3-pyridin-2-ylsulfanylpropan-2-ol? |
| A: LogP of 1-[(4-chlorophenyl)methoxy]-3-pyridin-2-ylsulfanylpropan-2-ol is 3.40480. |
| Q: What is the boiling point of 1-[(4-chlorophenyl)methoxy]-3-pyridin-2-ylsulfanylpropan-2-ol? |
| A: Boiling point of 1-[(4-chlorophenyl)methoxy]-3-pyridin-2-ylsulfanylpropan-2-ol is 480.8ºC at 760 mmHg. |
| Q: What is the InChIKey of 1-[(4-chlorophenyl)methoxy]-3-pyridin-2-ylsulfanylpropan-2-ol? |
| A: InChIKey of 1-[(4-chlorophenyl)methoxy]-3-pyridin-2-ylsulfanylpropan-2-ol is DHQVRSQXDBYKJW-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-[(4-chlorophenyl)methoxy]-3-pyridin-2-ylsulfanylpropan-2-ol? |
| A: SMILES notation of 1-[(4-chlorophenyl)methoxy]-3-pyridin-2-ylsulfanylpropan-2-ol is OC(COCc1ccc(Cl)cc1)CSc1ccccn1. |
| Q: What is the CAS number of 1-[(4-chlorophenyl)methoxy]-3-pyridin-2-ylsulfanylpropan-2-ol? |
| A: CAS number of 1-[(4-chlorophenyl)methoxy]-3-pyridin-2-ylsulfanylpropan-2-ol is 5357-23-3. |
| Q: What is the molecular formula of 1-[(4-chlorophenyl)methoxy]-3-pyridin-2-ylsulfanylpropan-2-ol? |
| A: Molecular formula of 1-[(4-chlorophenyl)methoxy]-3-pyridin-2-ylsulfanylpropan-2-ol is C15H16ClNO2S. |
| Q: What English synonyms does 1-[(4-chlorophenyl)methoxy]-3-pyridin-2-ylsulfanylpropan-2-ol have? |
| A: English synonyms of 1-[(4-chlorophenyl)methoxy]-3-pyridin-2-ylsulfanylpropan-2-ol: 1-[(4-chlorophenyl)methoxy]-3-pyridin-2-ylsulfanyl-propan-2-ol, (3-Amino-propyl)-dibutylboran, (3-Amino-propyl)-dibutylbor. |