methyl 2-(4-methylphenyl)-2-phenyl-acetate
Modify Date: 2025-10-02 12:11:14
methyl 2-(4-methylphenyl)-2-phenyl-acetate structure
|
Common Name | methyl 2-(4-methylphenyl)-2-phenyl-acetate | ||
|---|---|---|---|---|
| CAS Number | 5359-49-9 | Molecular Weight | 240.29700 | |
| Density | 1.08g/cm3 | Boiling Point | 340.7ºC at 760 mmHg | |
| Molecular Formula | C16H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.6ºC | |
| Name | methyl 2-(4-methylphenyl)-2-phenylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 340.7ºC at 760 mmHg |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.29700 |
| Flash Point | 133.6ºC |
| Exact Mass | 240.11500 |
| PSA | 26.30000 |
| LogP | 3.29990 |
| Index of Refraction | 1.555 |
| InChIKey | SLHUVOQYDHUKNY-UHFFFAOYSA-N |
| SMILES | COC(=O)C(c1ccccc1)c1ccc(C)cc1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-Tolyl-phenylessigsaeure-methylester |