2-(4-chloro-3-methyl-phenoxy)-2,3-dihydro-1H-naphtho[1,8-de][1,3,2]diazaphosphinine 2-oxide structure
|
Common Name | 2-(4-chloro-3-methyl-phenoxy)-2,3-dihydro-1H-naphtho[1,8-de][1,3,2]diazaphosphinine 2-oxide | ||
|---|---|---|---|---|
| CAS Number | 53596-32-0 | Molecular Weight | 344.73200 | |
| Density | 1.44g/cm3 | Boiling Point | 526.7ºC at 760 mmHg | |
| Molecular Formula | C17H14ClN2O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 272.3ºC | |
| Name | 2-(4-chloro-3-methyl-phenoxy)-2,3-dihydro-1H-naphtho[1,8-de][1,3,2]diazaphosphinine 2-oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 526.7ºC at 760 mmHg |
| Molecular Formula | C17H14ClN2O2P |
| Molecular Weight | 344.73200 |
| Flash Point | 272.3ºC |
| Exact Mass | 344.04800 |
| PSA | 60.17000 |
| LogP | 6.10210 |
| Index of Refraction | 1.698 |
| InChIKey | PHVANJRDFRMFSL-UHFFFAOYSA-N |
| SMILES | Cc1cc(OP2(=O)Nc3cccc4cccc(c34)N2)ccc1Cl |
|
~%
2-(4-chloro-3-m... CAS#:53596-32-0 |
| Literature: Naidu,M.S.R.; Reddy,C.D. Indian Journal of Chemistry, 1974 , vol. 12, p. 349 - 350 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-(4-Chloro-3-methylphenoxy)-2,3-dihydro-1H-naphtho(1,8-de)-1,3,2-diazaphosphorine 2-oxide |