sodium 2-hexyldecanoate structure
|
Common Name | sodium 2-hexyldecanoate | ||
|---|---|---|---|---|
| CAS Number | 536-37-8 | Molecular Weight | 278.40600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H31NaO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium,2-hexyldecanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H31NaO2 |
|---|---|
| Molecular Weight | 278.40600 |
| Exact Mass | 278.22200 |
| PSA | 40.13000 |
| LogP | 4.07350 |
| InChIKey | PJBYSIMNLVXLRD-UHFFFAOYSA-M |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)[O-].[Na+] |
| HS Code | 2915900090 |
|---|
|
~88%
sodium 2-hexyld... CAS#:536-37-8 |
| Literature: Abdullah, Norbani; Al-Hakem, Yasameen; Abdullah, Nazirah; Samsudin, Habibah; Tajidi, Nur Syamimi Ahmad Asian Journal of Chemistry, 2014 , vol. 26, # 4 p. 987 - 990 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| Decanoicacid,2-hexyl-,sodium salt (7CI,8CI,9CI) |
| Devaricin |
| Decanoic acid,2-hexyl-,sodium salt (1:1) |
| 2-Hexyl-decansaeure,Natrium-Salz |
| Sodium a-hexyldecanoate |
| EINECS 208-629-4 |
| Sodium 2-hexyldecanoate |
| 2-hexyl-decanoic acid,sodium-salt |