N-[(3-benzylsulfanyl-5-ethyl-1,2,4-triazol-4-yl)carbamothioyl]-5-(3,4-dimethylphenyl)furan-2-carboxamide structure
|
Common Name | N-[(3-benzylsulfanyl-5-ethyl-1,2,4-triazol-4-yl)carbamothioyl]-5-(3,4-dimethylphenyl)furan-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 5363-42-8 | Molecular Weight | 491.62800 | |
| Density | 1.31g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C25H25N5O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(3-benzylsulfanyl-5-ethyl-1,2,4-triazol-4-yl)carbamothioyl]-5-(3,4-dimethylphenyl)furan-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Molecular Formula | C25H25N5O2S2 |
| Molecular Weight | 491.62800 |
| Exact Mass | 491.14500 |
| PSA | 145.86000 |
| LogP | 5.91580 |
| Index of Refraction | 1.673 |
| InChIKey | RFDCGPDHVMWFTO-UHFFFAOYSA-N |
| SMILES | CCc1nnc(SCc2ccccc2)n1NC(=S)NC(=O)c1ccc(-c2ccc(C)c(C)c2)o1 |
| HS Code | 2933199090 |
|---|
|
~40%
N-[(3-benzylsul... CAS#:5363-42-8 |
| Literature: Gnichtel, Horst; Boehringer, Ulrich Chemische Berichte, 1980 , vol. 113, # 4 p. 1507 - 1513 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,4-diethyl-3,5-dimethyl-4H-pyrazole 1-oxide |
| 3,5-Dimethyl-4,4-diethylpyrazol-N-oxid |
| 4,4-Diethyl-3,5-diphenyl-4H-pyrazol-1-oxid |
| 3,5-Dimethyl-4,4-diethyl-4H-pyrazol-2-N-oxid |