4,4,5,5,5-pentafluoropentyl 4-methoxybenzoate structure
|
Common Name | 4,4,5,5,5-pentafluoropentyl 4-methoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 5363-79-1 | Molecular Weight | 312.23300 | |
| Density | 1.276g/cm3 | Boiling Point | 304.1ºC at 760 mmHg | |
| Molecular Formula | C13H13F5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.3ºC | |
| Name | 4,4,5,5,5-pentafluoropentyl 4-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.276g/cm3 |
|---|---|
| Boiling Point | 304.1ºC at 760 mmHg |
| Molecular Formula | C13H13F5O3 |
| Molecular Weight | 312.23300 |
| Flash Point | 133.3ºC |
| Exact Mass | 312.07800 |
| PSA | 35.53000 |
| LogP | 3.82980 |
| Index of Refraction | 1.436 |
| InChIKey | YLJZJQNMXOAPMT-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)OCCCC(F)(F)C(F)(F)F)cc1 |
| HS Code | 2934999090 |
|---|
|
~%
4,4,5,5,5-penta... CAS#:5363-79-1 |
| Literature: Cossar,B.C.; Reynolds,D.D. Journal of Heterocyclic Chemistry, 1965 , vol. 2, p. 430 - 440 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,3-Dibutyl-tetrahydro-4H-1,3-thiazinium |