1-Propanol,3,3'-[[3-(dimethylamino)propyl]imino]bis-, dimethanesulfonate (ester) (9CI) structure
|
Common Name | 1-Propanol,3,3'-[[3-(dimethylamino)propyl]imino]bis-, dimethanesulfonate (ester) (9CI) | ||
|---|---|---|---|---|
| CAS Number | 53638-48-5 | Molecular Weight | 374.51700 | |
| Density | 1.198g/cm3 | Boiling Point | 539.8ºC at 760mmHg | |
| Molecular Formula | C13H30N2O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.3ºC | |
| Name | 3-[3-(dimethylamino)propyl-(3-methylsulfonyloxypropyl)amino]propyl methanesulfonate |
|---|
| Density | 1.198g/cm3 |
|---|---|
| Boiling Point | 539.8ºC at 760mmHg |
| Molecular Formula | C13H30N2O6S2 |
| Molecular Weight | 374.51700 |
| Flash Point | 280.3ºC |
| Exact Mass | 374.15500 |
| PSA | 109.98000 |
| LogP | 2.13430 |
| Index of Refraction | 1.495 |
| InChIKey | FFAAROMWNFMVNG-UHFFFAOYSA-N |
| SMILES | CN(C)CCCN(CCCOS(C)(=O)=O)CCCOS(C)(=O)=O |
|
~%
1-Propanol,3,3'... CAS#:53638-48-5 |
| Literature: El Merzabani; Sakurai Chemical and Pharmaceutical Bulletin, 1973 , vol. 21, # 7 p. 1560 - 1563 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |