2(3H)-Benzothiazolimine, 6-methoxy-3-methyl-, hydrochloride (1:1)
Modify Date: 2025-09-22 07:50:15
2(3H)-Benzothiazolimine, 6-methoxy-3-methyl-, hydrochloride (1:1) structure
|
Common Name | 2(3H)-Benzothiazolimine, 6-methoxy-3-methyl-, hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 53641-26-2 | Molecular Weight | 230.72 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11ClN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2(3H)-Benzothiazolimine, 6-methoxy-3-methyl-, hydrochloride (1:1) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H11ClN2OS |
|---|---|
| Molecular Weight | 230.72 |
| InChIKey | SUFFTDKMAISOCQ-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)sc(=N)n2C.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2(3H)-Benzothiazolimine, 6-methoxy-3-methyl-, hydrochloride (1:1)? |
| A: InChIKey of 2(3H)-Benzothiazolimine, 6-methoxy-3-methyl-, hydrochloride (1:1) is SUFFTDKMAISOCQ-UHFFFAOYSA-N. |
| Q: What is the English name of 2(3H)-Benzothiazolimine, 6-methoxy-3-methyl-, hydrochloride (1:1)? |
| A: The English name of 2(3H)-Benzothiazolimine, 6-methoxy-3-methyl-, hydrochloride (1:1) is 2(3H)-Benzothiazolimine, 6-methoxy-3-methyl-, hydrochloride (1:1). |
| Q: What is the SMILES notation of 2(3H)-Benzothiazolimine, 6-methoxy-3-methyl-, hydrochloride (1:1)? |
| A: SMILES notation of 2(3H)-Benzothiazolimine, 6-methoxy-3-methyl-, hydrochloride (1:1) is COc1ccc2c(c1)sc(=N)n2C.Cl. |
| Q: What is the molecular formula of 2(3H)-Benzothiazolimine, 6-methoxy-3-methyl-, hydrochloride (1:1)? |
| A: Molecular formula of 2(3H)-Benzothiazolimine, 6-methoxy-3-methyl-, hydrochloride (1:1) is C9H11ClN2OS. |
| Q: What is the molecular weight of 2(3H)-Benzothiazolimine, 6-methoxy-3-methyl-, hydrochloride (1:1)? |
| A: Molecular weight of 2(3H)-Benzothiazolimine, 6-methoxy-3-methyl-, hydrochloride (1:1) is 230.72. |
| Q: What is the Chinese name of 53641-26-2? |
| A: Chinese name of 53641-26-2 is 53641-26-2. |
| Q: What is the CAS number of 2(3H)-Benzothiazolimine, 6-methoxy-3-methyl-, hydrochloride (1:1)? |
| A: CAS number of 2(3H)-Benzothiazolimine, 6-methoxy-3-methyl-, hydrochloride (1:1) is 53641-26-2. |