Oxazolo[5,4-d]pyrimidin-7(6H)-one, 2-phenyl-6-b-D-ribofuranosyl structure
|
Common Name | Oxazolo[5,4-d]pyrimidin-7(6H)-one, 2-phenyl-6-b-D-ribofuranosyl | ||
|---|---|---|---|---|
| CAS Number | 53641-68-2 | Molecular Weight | 345.30700 | |
| Density | 1.74g/cm3 | Boiling Point | 673.5ºC at 760 mmHg | |
| Molecular Formula | C16H15N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 361.1ºC | |
| Name | 2H-1,2-Oxazine,6-ethenyl-3,6-dihydro-2-phenyl |
|---|
| Density | 1.74g/cm3 |
|---|---|
| Boiling Point | 673.5ºC at 760 mmHg |
| Molecular Formula | C16H15N3O6 |
| Molecular Weight | 345.30700 |
| Flash Point | 361.1ºC |
| Exact Mass | 345.09600 |
| PSA | 130.84000 |
| Index of Refraction | 1.768 |
| InChIKey | IJKFIAPPEZLVBG-UHFFFAOYSA-N |
| SMILES | O=c1c2nc(-c3ccccc3)oc2ncn1C1OC(CO)C(O)C1O |
|
~%
Oxazolo[5,4-d]p... CAS#:53641-68-2 |
| Literature: Patil; Wise; Townsend; Bloch Journal of Medicinal Chemistry, 1974 , vol. 17, # 12 p. 1282 - 1285 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |