Picras-3-en-21-oicacid, 15-(acetyloxy)-13,20-epoxy-1,11,12-trihydroxy-2,16-dioxo-, methyl ester,(1b,11b,12a,15b) structure
|
Common Name | Picras-3-en-21-oicacid, 15-(acetyloxy)-13,20-epoxy-1,11,12-trihydroxy-2,16-dioxo-, methyl ester,(1b,11b,12a,15b) | ||
|---|---|---|---|---|
| CAS Number | 53663-03-9 | Molecular Weight | 480.46200 | |
| Density | 1.52g/cm3 | Boiling Point | 696.1ºC at 760mmHg | |
| Molecular Formula | C23H28O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.3ºC | |
| Name | isobruceine b |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 696.1ºC at 760mmHg |
| Molecular Formula | C23H28O11 |
| Molecular Weight | 480.46200 |
| Flash Point | 239.3ºC |
| Exact Mass | 480.16300 |
| PSA | 165.89000 |
| Index of Refraction | 1.614 |
| InChIKey | WAYNIXHIORQRDI-RWLFMTGCSA-N |
| SMILES | COC(=O)C12OCC34C(CC5C(C)=CC(=O)C(O)C5(C)C3C(O)C1O)OC(=O)C(OC(C)=O)C24 |
|
~%
Picras-3-en-21-... CAS#:53663-03-9 |
| Literature: Sakaki; Yoshimura; Ishibashi; et al. Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 11 p. 4702 - 4705 |
|
~%
Picras-3-en-21-... CAS#:53663-03-9 |
| Literature: Sakaki; Yoshimura; Ishibashi; et al. Bulletin of the Chemical Society of Japan, 1985 , vol. 58, # 9 p. 2680 - 2686 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| isobrucein-B |
| ISOBRUCEINE-B |