(2R,4R)-N1-(4-chlorophenyl)-4-methoxy-N2-(5-(2-oxopyridin-1(2H)-yl)pyridin-2-yl)pyrrolidine-1,2-dicarboxamide structure
|
Common Name | (2R,4R)-N1-(4-chlorophenyl)-4-methoxy-N2-(5-(2-oxopyridin-1(2H)-yl)pyridin-2-yl)pyrrolidine-1,2-dicarboxamide | ||
|---|---|---|---|---|
| CAS Number | 536747-62-3 | Molecular Weight | 467.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H22ClN5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2R,4R)-N1-(4-chlorophenyl)-4-methoxy-N2-(5-(2-oxopyridin-1(2H)-yl)pyridin-2-yl)pyrrolidine-1,2-dicarboxamide |
|---|
| Molecular Formula | C23H22ClN5O4 |
|---|---|
| Molecular Weight | 467.9 |
| InChIKey | RPRRBPGLRUYEKO-RTBURBONSA-N |
| SMILES | COC1CC(C(=O)Nc2ccc(-n3ccccc3=O)cn2)N(C(=O)Nc2ccc(Cl)cc2)C1 |
|
Name: Anticoagulant activity in human plasma assessed as concentration required to double t...
Source: ChEMBL
Target: Plasma
External Id: CHEMBL956031
|
|
Name: Inhibition of human Factor-10a
Source: ChEMBL
Target: Coagulation factor X
External Id: CHEMBL956028
|
|
Name: Half life in iv dosed rat by cassette studies
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL956029
|