2-(N-ethyl-4-formylanilino)ethyl benzoate structure
|
Common Name | 2-(N-ethyl-4-formylanilino)ethyl benzoate | ||
|---|---|---|---|---|
| CAS Number | 53683-41-3 | Molecular Weight | 297.34800 | |
| Density | 1.168g/cm3 | Boiling Point | 463.2ºC at 760mmHg | |
| Molecular Formula | C18H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.9ºC | |
| Name | 2-(N-ethyl-4-formylanilino)ethyl benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.168g/cm3 |
|---|---|
| Boiling Point | 463.2ºC at 760mmHg |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.34800 |
| Flash Point | 233.9ºC |
| Exact Mass | 297.13600 |
| PSA | 46.61000 |
| LogP | 3.18240 |
| Index of Refraction | 1.607 |
| InChIKey | TYZURZJBRCXDGB-UHFFFAOYSA-N |
| SMILES | CCN(CCOC(=O)c1ccccc1)c1ccc(C=O)cc1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-[ethyl(4-formylphenyl)amino]ethyl benzoate |
| EINECS 258-699-5 |