1-(4-benzoylphenyl)ethanone
1-(4-benzoylphenyl)ethanone structure
|
Common Name | 1-(4-benzoylphenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 53689-84-2 | Molecular Weight | 224.25500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(4-benzoylphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H12O2 |
|---|---|
| Molecular Weight | 224.25500 |
| Exact Mass | 224.08400 |
| PSA | 34.14000 |
| LogP | 3.12020 |
| InChIKey | DULLEKOHORMWFS-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(C(=O)c2ccccc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 3 | |
CAS#:98-88-4
CAS#:149104-90-5
CAS#:586-89-0
CAS#:98-80-6
CAS#:13329-40-3
CAS#:201230-82-2
CAS#:1052721-18-2
CAS#:75-16-1
CAS#:99-90-1
CAS#:611-95-0
CAS#:26077-80-5
CAS#:620-85-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-(4-benzoylphenyl)ethan-1-one |
| 4-acetobenzophenone |
| Ethanone,1-(4-benzoylphenyl) |
| 1-(4-benzoylphenyl) ethanone |
| 4-Acetyl-benzophenon |
| 4-acetyl-benzophenone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-(4-benzoylphenyl)ethanone? |
| A: Molecular weight of 1-(4-benzoylphenyl)ethanone is 224.25500. |
| Q: What is the LogP of 1-(4-benzoylphenyl)ethanone? |
| A: LogP of 1-(4-benzoylphenyl)ethanone is 3.12020. |
| Q: What is the English name of 1-(4-benzoylphenyl)ethanone? |
| A: The English name of 1-(4-benzoylphenyl)ethanone is 1-(4-benzoylphenyl)ethanone. |
| Q: What is the polar surface area (PSA) of 1-(4-benzoylphenyl)ethanone? |
| A: Polar surface area (PSA) of 1-(4-benzoylphenyl)ethanone is 34.14000. |
| Q: What are the upstream materials of 1-(4-benzoylphenyl)ethanone? |
| A: Related upstream materials(CAS) of 1-(4-benzoylphenyl)ethanone: 98-88-4;149104-90-5;586-89-0;98-80-6;13329-40-3;201230-82-2;1052721-18-2;75-16-1;99-90-1. |
| Q: What English synonyms does 1-(4-benzoylphenyl)ethanone have? |
| A: English synonyms of 1-(4-benzoylphenyl)ethanone: 1-(4-benzoylphenyl)ethan-1-one, 4-acetobenzophenone, Ethanone,1-(4-benzoylphenyl), 1-(4-benzoylphenyl) ethanone, 4-Acetyl-benzophenon, 4-acetyl-benzophenone. |
| Q: What is the SMILES notation of 1-(4-benzoylphenyl)ethanone? |
| A: SMILES notation of 1-(4-benzoylphenyl)ethanone is CC(=O)c1ccc(C(=O)c2ccccc2)cc1. |
| Q: What is the Chinese name of 53689-84-2? |
| A: Chinese name of 53689-84-2 is 53689-84-2. |
| Q: What are the downstream products of 1-(4-benzoylphenyl)ethanone? |
| A: Related downstream products(CAS) of 1-(4-benzoylphenyl)ethanone: 611-95-0;26077-80-5;620-85-9. |
| Q: What is the CAS number of 1-(4-benzoylphenyl)ethanone? |
| A: CAS number of 1-(4-benzoylphenyl)ethanone is 53689-84-2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |