N-(3,5-dimethyl-2,4,6-trinitro-phenyl)-3,5-dimethyl-2,4,6-trinitro-aniline structure
|
Common Name | N-(3,5-dimethyl-2,4,6-trinitro-phenyl)-3,5-dimethyl-2,4,6-trinitro-aniline | ||
|---|---|---|---|---|
| CAS Number | 5369-24-4 | Molecular Weight | 495.31400 | |
| Density | 1.698g/cm3 | Boiling Point | 551.6ºC at 760 mmHg | |
| Molecular Formula | C16H13N7O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.4ºC | |
| Name | N-(3,5-dimethyl-2,4,6-trinitrophenyl)-3,5-dimethyl-2,4,6-trinitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.698g/cm3 |
|---|---|
| Boiling Point | 551.6ºC at 760 mmHg |
| Molecular Formula | C16H13N7O12 |
| Molecular Weight | 495.31400 |
| Flash Point | 287.4ºC |
| Exact Mass | 495.06200 |
| PSA | 286.95000 |
| LogP | 7.32520 |
| Index of Refraction | 1.712 |
| InChIKey | KLRUMXLUOGELHG-UHFFFAOYSA-N |
| SMILES | Cc1c([N+](=O)[O-])c(C)c([N+](=O)[O-])c(Nc2c([N+](=O)[O-])c(C)c([N+](=O)[O-])c(C)c2[N+](=O)[O-])c1[N+](=O)[O-] |
| HS Code | 2921499090 |
|---|
|
~%
N-(3,5-dimethyl... CAS#:5369-24-4 |
| Literature: Blanksma Recueil des Travaux Chimiques des Pays-Bas, 1906 , vol. 25, p. 370 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2.4.6.2'.4'.6'-Hexanitro-3.5.3'.5'-tetramethyl-diphenylamin |
| 3,3',5,5'-Dipikryl-amin |