Oxazole,2,2'-(1,4-phenylene)bis[5-(4-butoxyphenyl)- structure
|
Common Name | Oxazole,2,2'-(1,4-phenylene)bis[5-(4-butoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 53693-69-9 | Molecular Weight | 508.60700 | |
| Density | 1.131g/cm3 | Boiling Point | 679.6ºC at 760mmHg | |
| Molecular Formula | C32H32N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 364.8ºC | |
| Name | 5-(4-butoxyphenyl)-2-[4-[5-(4-butoxyphenyl)-1,3-oxazol-2-yl]phenyl]-1,3-oxazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.131g/cm3 |
|---|---|
| Boiling Point | 679.6ºC at 760mmHg |
| Molecular Formula | C32H32N2O4 |
| Molecular Weight | 508.60700 |
| Flash Point | 364.8ºC |
| Exact Mass | 508.23600 |
| PSA | 70.52000 |
| LogP | 8.68840 |
| Index of Refraction | 1.565 |
| InChIKey | JGQCZWHFOQVQGO-UHFFFAOYSA-N |
| SMILES | CCCCOc1ccc(-c2cnc(-c3ccc(-c4ncc(-c5ccc(OCCCC)cc5)o4)cc3)o2)cc1 |
|
~%
Oxazole,2,2'-(1... CAS#:53693-69-9 |
| Literature: Pavlopoulos,T.G.; Hammond,P.R. Journal of the American Chemical Society, 1974 , vol. 96, p. 6568 - 6579 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5,5'-bis-(4-butoxy-phenyl)-2,2'-p-phenylene-bis-oxazole |
| 1,4-Bis(5-p-n-butoxyphenyloxazol-2-yl)benzene |
| 1,4-Bis-(5-p-butoxyphenyloxazol-2-yl)benzol |