dichlorophenolindophenol
Modify Date: 2026-08-03 22:19:15
dichlorophenolindophenol structure
|
Common Name | dichlorophenolindophenol | ||
|---|---|---|---|---|
| CAS Number | 537-14-4 | Molecular Weight | 268.09500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H7Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | dichlorophenolindophenol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H7Cl2NO2 |
|---|---|
| Molecular Weight | 268.09500 |
| Exact Mass | 266.98500 |
| PSA | 49.66000 |
| LogP | 3.46660 |
| InChIKey | FBWADIKARMIWNM-UHFFFAOYSA-N |
| SMILES | O=C1C=CC(=Nc2cc(Cl)c(O)c(Cl)c2)C=C1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-((3,5-Dichloro-4-hydroxyphenyl)imino)-2,5-cyclohexadien-1-one |
| 2,6-Dichlorophenolindophenol |
| 2,6-dichloroindophenol |
| [1,4]benzoquinone-mono-(3,5-dichloro-4-hydroxy-phenylimine) |
| [1,4]Benzochinon-mono-(3,5-dichlor-4-hydroxy-phenylimin) |
| 2,6-di-chloro-phenolindophenol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 537-14-4? |
| A: Chinese name of 537-14-4 is 537-14-4. |
| Q: What English synonyms does dichlorophenolindophenol have? |
| A: English synonyms of dichlorophenolindophenol: 4-((3,5-Dichloro-4-hydroxyphenyl)imino)-2,5-cyclohexadien-1-one, 2,6-Dichlorophenolindophenol, 2,6-dichloroindophenol, [1,4]benzoquinone-mono-(3,5-dichloro-4-hydroxy-phenylimine), [1,4]Benzochinon-mono-(3,5-dichlor-4-hydroxy-phenylimin), 2,6-di-chloro-phenolindophenol. |
| Q: What is the CAS number of dichlorophenolindophenol? |
| A: CAS number of dichlorophenolindophenol is 537-14-4. |
| Q: What is the polar surface area (PSA) of dichlorophenolindophenol? |
| A: Polar surface area (PSA) of dichlorophenolindophenol is 49.66000. |
| Q: What is the molecular formula of dichlorophenolindophenol? |
| A: Molecular formula of dichlorophenolindophenol is C12H7Cl2NO2. |
| Q: What is the LogP of dichlorophenolindophenol? |
| A: LogP of dichlorophenolindophenol is 3.46660. |
| Q: What is the molecular weight of dichlorophenolindophenol? |
| A: Molecular weight of dichlorophenolindophenol is 268.09500. |
| Q: What is the SMILES notation of dichlorophenolindophenol? |
| A: SMILES notation of dichlorophenolindophenol is O=C1C=CC(=Nc2cc(Cl)c(O)c(Cl)c2)C=C1. |
| Q: What is the English name of dichlorophenolindophenol? |
| A: The English name of dichlorophenolindophenol is dichlorophenolindophenol. |
| Q: What is the InChIKey of dichlorophenolindophenol? |
| A: InChIKey of dichlorophenolindophenol is FBWADIKARMIWNM-UHFFFAOYSA-N. |