1-(4-chlorophenyl)non-1-en-3-ol structure
|
Common Name | 1-(4-chlorophenyl)non-1-en-3-ol | ||
|---|---|---|---|---|
| CAS Number | 53710-42-2 | Molecular Weight | 252.78000 | |
| Density | 1.056g/cm3 | Boiling Point | 379.3ºC at 760 mmHg | |
| Molecular Formula | C15H21ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.2ºC | |
| Name | 1-(4-chlorophenyl)non-1-en-3-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.056g/cm3 |
|---|---|
| Boiling Point | 379.3ºC at 760 mmHg |
| Molecular Formula | C15H21ClO |
| Molecular Weight | 252.78000 |
| Flash Point | 183.2ºC |
| Exact Mass | 252.12800 |
| PSA | 20.23000 |
| LogP | 4.68450 |
| Index of Refraction | 1.55 |
| InChIKey | VAMSMIPFRSEHEJ-FMIVXFBMSA-N |
| SMILES | CCCCCCC(O)C=Cc1ccc(Cl)cc1 |
|
~%
1-(4-chlorophen... CAS#:53710-42-2 |
| Literature: Taylor,W.G.; Dimmock,J.R. Canadian Journal of Chemistry, 1974 , vol. 52, p. 2522 - 2530 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Ethene,1-(ethylthio)-2-(methylthio)-,(Z) |
| Ethene,1-(ethylthio)-2-(methylthio)-,(E) |
| (E)-1-(methylthio)-2-(ethylthio)ethylene |
| (E)-1-(p-Chlorphenyl)-1-nonen-3-ol |