5-[2-(Diethylamino)ethoxy]-3-methyl-1-phenyl-1H-pyrazole structure
|
Common Name | 5-[2-(Diethylamino)ethoxy]-3-methyl-1-phenyl-1H-pyrazole | ||
|---|---|---|---|---|
| CAS Number | 5372-13-4 | Molecular Weight | 273.37300 | |
| Density | 1.03g/cm3 | Boiling Point | 394.5ºC at 760 mmHg | |
| Molecular Formula | C16H23N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.4ºC | |
| Name | N,N-diethyl-2-(5-methyl-2-phenylpyrazol-3-yl)oxyethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.03g/cm3 |
|---|---|
| Boiling Point | 394.5ºC at 760 mmHg |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.37300 |
| Flash Point | 192.4ºC |
| Exact Mass | 273.18400 |
| PSA | 30.29000 |
| LogP | 2.90130 |
| Index of Refraction | 1.542 |
| InChIKey | BPDKYROJEGRHLU-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOc1cc(C)nn1-c1ccccc1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| p-314 |