1-Benzyl-5-[2-(dimethylamino)ethoxy]-3-methyl-1H-pyrazole structure
|
Common Name | 1-Benzyl-5-[2-(dimethylamino)ethoxy]-3-methyl-1H-pyrazole | ||
|---|---|---|---|---|
| CAS Number | 5372-15-6 | Molecular Weight | 259.34700 | |
| Density | 1.04g/cm3 | Boiling Point | 402.9ºC at 760 mmHg | |
| Molecular Formula | C15H21N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.4ºC | |
| Name | 2-(2-benzyl-5-methylpyrazol-3-yl)oxy-N,N-dimethylethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.04g/cm3 |
|---|---|
| Boiling Point | 402.9ºC at 760 mmHg |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.34700 |
| Flash Point | 197.4ºC |
| Exact Mass | 259.16800 |
| PSA | 30.29000 |
| LogP | 2.18020 |
| Index of Refraction | 1.546 |
| InChIKey | ROWFYAJOERBGDW-UHFFFAOYSA-N |
| SMILES | Cc1cc(OCCN(C)C)n(Cc2ccccc2)n1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| [2-(2-benzyl-5-methyl-2H-pyrazol-3-yloxy)-ethyl]-dimethyl-amine |
| Pyrazole,1-benzyl-5-(2-(dimethylamino)ethoxy)-3-methyl |
| B-313 |
| 1-Benzyl-3-methyl-5-(2-dimethylaminoethoxy)-pyrazol |
| 1-Benzyl-5-(2-(dimethylamino)ethoxy)-3-methylpyrazole |