1,1-Ethanediamine,2,2,2-trichloro-N,N'-bis(3,4-dichlorophenyl)- structure
|
Common Name | 1,1-Ethanediamine,2,2,2-trichloro-N,N'-bis(3,4-dichlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 53723-87-8 | Molecular Weight | 453.40600 | |
| Density | 1.669g/cm3 | Boiling Point | 621.7ºC at 760mmHg | |
| Molecular Formula | C14H9Cl7N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 329.8ºC | |
| Name | 2,2,2-Trichlor-N-(2-chlor-aethyl)-acetamid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.669g/cm3 |
|---|---|
| Boiling Point | 621.7ºC at 760mmHg |
| Molecular Formula | C14H9Cl7N2 |
| Molecular Weight | 453.40600 |
| Flash Point | 329.8ºC |
| Exact Mass | 449.85900 |
| PSA | 24.06000 |
| LogP | 7.66650 |
| Index of Refraction | 1.689 |
| InChIKey | SRLLHBBTZZPDBN-UHFFFAOYSA-N |
| SMILES | Clc1ccc(NC(Nc2ccc(Cl)c(Cl)c2)C(Cl)(Cl)Cl)cc1Cl |
|
~%
1,1-Ethanediami... CAS#:53723-87-8 |
| Literature: Beaver et al. Journal of the American Chemical Society, 1957 , vol. 79, p. 1236,1242 Journal of Organic Chemistry, 1959 , vol. 24, p. 1676 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,2,2-trichloro-N,N'-bis(3,4-dichlorophenyl)-1,1-ethanediamine |
| Trichloressigsaeure-(2.2'-dichlor-diaethylamid) |
| 2,2,2-trichloro-N,N'-bis-(3,4-dichloro-phenyl)-ethylidenediamine |
| trichloro-acetic acid-(2-chloro-ethylamide) |
| Trichlor-essigsaeure-[bis-(2-chlor-aethyl)-amid] |
| trichloro-acetic acid-[bis-(2-chloro-ethyl)-amide] |
| Trichlor-essigsaeure-(2-chlor-aethylamid) |
| 2,2,2-Trichlor-N,N'-bis-(3,4-dichlor-phenyl)-aethylidendiamin |
| 2,2,2-Trichlor-N,N-bis-(2-chlor-aethyl)-acetamid |