ethyl 4-acetyl-5-methoxy-3-methyl-benzofuran-2-carboxylate structure
|
Common Name | ethyl 4-acetyl-5-methoxy-3-methyl-benzofuran-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 53725-07-8 | Molecular Weight | 276.28500 | |
| Density | 1.188g/cm3 | Boiling Point | 395ºC at 760 mmHg | |
| Molecular Formula | C15H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.7ºC | |
| Name | ethyl 4-acetyl-5-methoxy-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.188g/cm3 |
|---|---|
| Boiling Point | 395ºC at 760 mmHg |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.28500 |
| Flash Point | 192.7ºC |
| Exact Mass | 276.10000 |
| PSA | 65.74000 |
| LogP | 3.12910 |
| Index of Refraction | 1.552 |
| InChIKey | DNJXQGLYNGXERD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1oc2ccc(OC)c(C(C)=O)c2c1C |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-acetyl-5-methoxy-3-methyl-benzofuran-2-carboxylic acid ethyl ester |