Antibacterial agent 65 structure
|
Common Name | Antibacterial agent 65 | ||
|---|---|---|---|---|
| CAS Number | 53744-27-7 | Molecular Weight | 268.30700 | |
| Density | 1.128g/cm3 | Boiling Point | 421.8ºC at 760 mmHg | |
| Molecular Formula | C17H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.7ºC | |
Use of Antibacterial agent 65Antibacterial agent 65 is a potential antimicrobial and antioxidant agent. |
| Name | 3-(3,4-dimethoxyphenyl)-1-phenylprop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Description | Antibacterial agent 65 is a potential antimicrobial and antioxidant agent. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.128g/cm3 |
|---|---|
| Boiling Point | 421.8ºC at 760 mmHg |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.30700 |
| Flash Point | 200.7ºC |
| Exact Mass | 268.11000 |
| PSA | 35.53000 |
| LogP | 3.59990 |
| Index of Refraction | 1.591 |
| InChIKey | LSHZPTCZLWATBZ-CSKARUKUSA-N |
| SMILES | COc1ccc(C=CC(=O)c2ccccc2)cc1OC |
| Storage condition | 2-8°C |
| HS Code | 2914509090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3,4-dimethoxybenzylideneacetophenone |
| 3,4-dimethoxy-chalcone |
| 3,4-Dimethoxy-chalkon |