4,4-Dimethyl-2-methylenevaleraldehyde structure
|
Common Name | 4,4-Dimethyl-2-methylenevaleraldehyde | ||
|---|---|---|---|---|
| CAS Number | 5375-28-0 | Molecular Weight | 281.23000 | |
| Density | 1.446g/cm3 | Boiling Point | 348.8ºC at 760 mmHg | |
| Molecular Formula | C14H10F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.7ºC | |
| Name | 4-[[4-(trifluoromethoxy)anilino]methylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.446g/cm3 |
|---|---|
| Boiling Point | 348.8ºC at 760 mmHg |
| Molecular Formula | C14H10F3NO2 |
| Molecular Weight | 281.23000 |
| Flash Point | 164.7ºC |
| Exact Mass | 281.06600 |
| PSA | 38.33000 |
| LogP | 3.64910 |
| Index of Refraction | 1.634 |
| InChIKey | LTQJJAXSLNUEDJ-UHFFFAOYSA-N |
| SMILES | Oc1ccc(C=Nc2ccc(OC(F)(F)F)cc2)cc1 |
| HS Code | 2912190090 |
|---|
|
~%
4,4-Dimethyl-2-... CAS#:5375-28-0 |
| Literature: Bajgrowicz, Jerzy A.; Berg-Schultz, Katja; Brunner, Gerhard Bioorganic and Medicinal Chemistry, 2003 , vol. 11, # 13 p. 2931 - 2946 |
|
~%
4,4-Dimethyl-2-... CAS#:5375-28-0 |
| Literature: Hadley et al. Journal of the Chemical Society, 1954 , p. 1416,1419 |
| HS Code | 2912190090 |
|---|---|
| Summary | 2912190090 acyclic aldehydes without other oxygen function。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2-neopentyl-acrylaldehyde |