1,2-Benzenediol,5-methyl-3-(phenylsulfonyl) structure
|
Common Name | 1,2-Benzenediol,5-methyl-3-(phenylsulfonyl) | ||
|---|---|---|---|---|
| CAS Number | 53760-95-5 | Molecular Weight | 264.29700 | |
| Density | 1.384g/cm3 | Boiling Point | 496.9ºC at 760mmHg | |
| Molecular Formula | C13H12O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.3ºC | |
| Name | 3-(benzenesulfonyl)-5-methylbenzene-1,2-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.384g/cm3 |
|---|---|
| Boiling Point | 496.9ºC at 760mmHg |
| Molecular Formula | C13H12O4S |
| Molecular Weight | 264.29700 |
| Flash Point | 254.3ºC |
| Exact Mass | 264.04600 |
| PSA | 82.98000 |
| LogP | 3.31980 |
| Index of Refraction | 1.63 |
| InChIKey | JZVZYNSTKQDCHA-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)c(O)c(S(=O)(=O)c2ccccc2)c1 |
|
~%
1,2-Benzenediol... CAS#:53760-95-5 |
| Literature: Siuda; Habal Journal of Medicinal Chemistry, 1974 , vol. 17, # 11 p. 1173 - 1177 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,3-Dihydroxy-5-methyldiphenylsulfon |