1,3-Butanedione,4,4,4-trifluoro-1-(3-methylphenyl)- structure
|
Common Name | 1,3-Butanedione,4,4,4-trifluoro-1-(3-methylphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 53764-99-1 | Molecular Weight | 230.183 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 270.2±35.0 °C at 760 mmHg | |
| Molecular Formula | C11H9F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 94.2±22.8 °C | |
| Name | 4,4,4-trifluoro-1-(3-methylphenyl)butane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 270.2±35.0 °C at 760 mmHg |
| Molecular Formula | C11H9F3O2 |
| Molecular Weight | 230.183 |
| Flash Point | 94.2±22.8 °C |
| Exact Mass | 230.055466 |
| PSA | 34.14000 |
| LogP | 4.63 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.466 |
| InChIKey | VOFWLZQTWRLBTR-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C(=O)CC(=O)C(F)(F)F)c1 |
| HS Code | 2914700090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4,4,4-Trifluoro-1-(3-methylphenyl)-1,3-butanedione |
| 1,3-Butanedione, 4,4,4-trifluoro-1-(3-methylphenyl)- |
| 1,3-Butanedione,4,4,4-trifluoro-1-(3-methylphenyl)- |