3,5-Bis-(2-oxo-pyrrolidin-1-yl)benzoic Acid Methyl Ester
Modify Date: 2025-09-18 19:10:49
3,5-Bis-(2-oxo-pyrrolidin-1-yl)benzoic Acid Methyl Ester structure
|
Common Name | 3,5-Bis-(2-oxo-pyrrolidin-1-yl)benzoic Acid Methyl Ester | ||
|---|---|---|---|---|
| CAS Number | 537657-83-3 | Molecular Weight | 302.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,5-Bis-(2-oxo-pyrrolidin-1-yl)benzoic Acid Methyl Ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H18N2O4 |
|---|---|
| Molecular Weight | 302.32 |
| InChIKey | RJCTUPZUVYYPGV-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(N2CCCC2=O)cc(N2CCCC2=O)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 537657-83-3? |
| A: Chinese name of 537657-83-3 is 537657-83-3. |
| Q: What is the SMILES notation of 3,5-Bis-(2-oxo-pyrrolidin-1-yl)benzoic Acid Methyl Ester? |
| A: SMILES notation of 3,5-Bis-(2-oxo-pyrrolidin-1-yl)benzoic Acid Methyl Ester is COC(=O)c1cc(N2CCCC2=O)cc(N2CCCC2=O)c1. |
| Q: What is the molecular formula of 3,5-Bis-(2-oxo-pyrrolidin-1-yl)benzoic Acid Methyl Ester? |
| A: Molecular formula of 3,5-Bis-(2-oxo-pyrrolidin-1-yl)benzoic Acid Methyl Ester is C16H18N2O4. |
| Q: What is the English name of 3,5-Bis-(2-oxo-pyrrolidin-1-yl)benzoic Acid Methyl Ester? |
| A: The English name of 3,5-Bis-(2-oxo-pyrrolidin-1-yl)benzoic Acid Methyl Ester is 3,5-Bis-(2-oxo-pyrrolidin-1-yl)benzoic Acid Methyl Ester. |
| Q: What is the CAS number of 3,5-Bis-(2-oxo-pyrrolidin-1-yl)benzoic Acid Methyl Ester? |
| A: CAS number of 3,5-Bis-(2-oxo-pyrrolidin-1-yl)benzoic Acid Methyl Ester is 537657-83-3. |
| Q: What is the molecular weight of 3,5-Bis-(2-oxo-pyrrolidin-1-yl)benzoic Acid Methyl Ester? |
| A: Molecular weight of 3,5-Bis-(2-oxo-pyrrolidin-1-yl)benzoic Acid Methyl Ester is 302.32. |
| Q: What is the InChIKey of 3,5-Bis-(2-oxo-pyrrolidin-1-yl)benzoic Acid Methyl Ester? |
| A: InChIKey of 3,5-Bis-(2-oxo-pyrrolidin-1-yl)benzoic Acid Methyl Ester is RJCTUPZUVYYPGV-UHFFFAOYSA-N. |