trans-Clopenthixol
Modify Date: 2026-06-27 17:17:50
trans-Clopenthixol structure
|
Common Name | trans-Clopenthixol | ||
|---|---|---|---|---|
| CAS Number | 53772-84-2 | Molecular Weight | 401.0 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H25ClN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | trans-Clopenthixol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H25ClN2OS |
|---|---|
| Molecular Weight | 401.0 |
| InChIKey | WFPIAZLQTJBIFN-BLLMUTORSA-N |
| SMILES | C1CN(CCN1CC/C=C/2\C3=CC=CC=C3SC4=C2C=C(C=C4)Cl)CCO |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: S16 Schwann cell viability assay (CellTiter-Glo assay)
Source: NCGC
Target: N/A
External Id: cmt-p4-fda-celltiter_regid
|
|
Name: Biochemical firefly luciferase enzyme assay for NPC
Source: NCGC
Target: Luciferase [Photinus pyralis]
External Id: adst-fluc-km-fda-o1_regid
|
|
Name: S16 Schwann cell PMP22 intronic element firefly luciferase assay
Source: NCGC
Target: peripheral myelin protein 22 [Rattus norvegicus]
External Id: cmt-p4-fluc-fda_regid
|
|
Name: qHTS for Inhibitors of Polymerase Kappa
Source: NCGC
Target: DNA polymerase kappa [Homo sapiens]
External Id: PolK100
|
Total 5, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of trans-Clopenthixol? |
| A: Molecular weight of trans-Clopenthixol is 401.0. |
| Q: What is the SMILES notation of trans-Clopenthixol? |
| A: SMILES notation of trans-Clopenthixol is C1CN(CCN1CC/C=C/2\C3=CC=CC=C3SC4=C2C=C(C=C4)Cl)CCO. |
| Q: What is the CAS number of trans-Clopenthixol? |
| A: CAS number of trans-Clopenthixol is 53772-84-2. |
| Q: What is the molecular formula of trans-Clopenthixol? |
| A: Molecular formula of trans-Clopenthixol is C22H25ClN2OS. |
| Q: What is the InChIKey of trans-Clopenthixol? |
| A: InChIKey of trans-Clopenthixol is WFPIAZLQTJBIFN-BLLMUTORSA-N. |
| Q: What is the Chinese name of 53772-84-2? |
| A: Chinese name of 53772-84-2 is 53772-84-2. |
| Q: What is the English name of trans-Clopenthixol? |
| A: The English name of trans-Clopenthixol is trans-Clopenthixol. |