5-(2,4-Dichlorophenoxy)-2-nitrobenzoic acid structure
|
Common Name | 5-(2,4-Dichlorophenoxy)-2-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 53774-07-5 | Molecular Weight | 328.104 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 457.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C13H7Cl2NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.4±28.7 °C | |
| Name | 5-(2,4-Dichlorophenoxy)-2-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 457.4±45.0 °C at 760 mmHg |
| Molecular Formula | C13H7Cl2NO5 |
| Molecular Weight | 328.104 |
| Flash Point | 230.4±28.7 °C |
| Exact Mass | 326.970123 |
| PSA | 92.35000 |
| LogP | 4.55 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.650 |
| InChIKey | IUSYSZLVZMUVDO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(Oc2ccc(Cl)cc2Cl)ccc1[N+](=O)[O-] |
| HS Code | 2918990090 |
|---|
|
~%
5-(2,4-Dichloro... CAS#:53774-07-5 |
| Literature: Imperial Chemical Industries Limited Patent: US4285723 A1, 1981 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-(2,4-dichloro phenoxy)-2-nitrobenzoic acid |
| MC 4875 |
| WNR BVQ DOR BG DG |
| Bifenox acid |
| 5449401 |
| Benzoic acid, 5-(2,4-dichlorophenoxy)-2-nitro- |
| 2-nitro-5-(2',4'-dichlorophenoxy)benzoate |
| 2,4-dichloro-3'-carboxy-4'-nitrodiphenyl ether |
| Benzoic acid,5-(2,4-dichlorophenoxy)-2-nitro |
| MCTR 172-78 |
| 3-carboxy-4-nitro-2',4'-dichlorodiphenyl ether |
| 5-(2,4-Dichlorophenoxy)-2-nitrobenzoic acid |
| 2-nitro-5-(2',4'-dichlorophenoxy)benzoic acid |