N-butyl-N-(3-triethoxysilylpropyl)butan-1-amine
N-butyl-N-(3-triethoxysilylpropyl)butan-1-amine structure
|
Common Name | N-butyl-N-(3-triethoxysilylpropyl)butan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 53813-18-6 | Molecular Weight | 333.58200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H39NO3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-butyl-N-(3-triethoxysilylpropyl)butan-1-amine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H39NO3Si |
|---|---|
| Molecular Weight | 333.58200 |
| Exact Mass | 333.27000 |
| PSA | 30.93000 |
| LogP | 4.32710 |
| InChIKey | DLAUQJZKDAKQGO-UHFFFAOYSA-N |
| SMILES | CCCCN(CCCC)CCC[Si](OCC)(OCC)OCC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
N-butyl-N-(3-tr... CAS#:53813-18-6 |
| Literature: Belyakova,Z.V. et al. J. Gen. Chem. USSR (Engl. Transl.), 1974 , vol. 44, p. 1484 - 1489,1456 - 1460 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-Butanamine,N-butyl-N-[3-(triethoxysilyl)propyl] |
| <3-(Dibutylamino)propyl>triethoxysilan |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 53813-18-6? |
| A: Chinese name of 53813-18-6 is 53813-18-6. |
| Q: What is the molecular weight of N-butyl-N-(3-triethoxysilylpropyl)butan-1-amine? |
| A: Molecular weight of N-butyl-N-(3-triethoxysilylpropyl)butan-1-amine is 333.58200. |
| Q: What are the upstream materials of N-butyl-N-(3-triethoxysilylpropyl)butan-1-amine? |
| A: Related upstream materials(CAS) of N-butyl-N-(3-triethoxysilylpropyl)butan-1-amine: 998-30-1;53826-28-1. |
| Q: What is the LogP of N-butyl-N-(3-triethoxysilylpropyl)butan-1-amine? |
| A: LogP of N-butyl-N-(3-triethoxysilylpropyl)butan-1-amine is 4.32710. |
| Q: What is the CAS number of N-butyl-N-(3-triethoxysilylpropyl)butan-1-amine? |
| A: CAS number of N-butyl-N-(3-triethoxysilylpropyl)butan-1-amine is 53813-18-6. |
| Q: What is the InChIKey of N-butyl-N-(3-triethoxysilylpropyl)butan-1-amine? |
| A: InChIKey of N-butyl-N-(3-triethoxysilylpropyl)butan-1-amine is DLAUQJZKDAKQGO-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N-butyl-N-(3-triethoxysilylpropyl)butan-1-amine? |
| A: Molecular formula of N-butyl-N-(3-triethoxysilylpropyl)butan-1-amine is C17H39NO3Si. |
| Q: What is the polar surface area (PSA) of N-butyl-N-(3-triethoxysilylpropyl)butan-1-amine? |
| A: Polar surface area (PSA) of N-butyl-N-(3-triethoxysilylpropyl)butan-1-amine is 30.93000. |
| Q: What is the SMILES notation of N-butyl-N-(3-triethoxysilylpropyl)butan-1-amine? |
| A: SMILES notation of N-butyl-N-(3-triethoxysilylpropyl)butan-1-amine is CCCCN(CCCC)CCC[Si](OCC)(OCC)OCC. |
| Q: What English synonyms does N-butyl-N-(3-triethoxysilylpropyl)butan-1-amine have? |
| A: English synonyms of N-butyl-N-(3-triethoxysilylpropyl)butan-1-amine: 1-Butanamine,N-butyl-N-[3-(triethoxysilyl)propyl], triethoxysilan. |