1,2-Benzenediol, 3,6-dinitro- (9CI) structure
|
Common Name | 1,2-Benzenediol, 3,6-dinitro- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 53816-91-4 | Molecular Weight | 200.10600 | |
| Density | 1.819g/cm3 | Boiling Point | 299.7ºC at 760mmHg | |
| Molecular Formula | C6H4N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135ºC | |
| Name | 3,6-dinitrobenzene-1,2-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.819g/cm3 |
|---|---|
| Boiling Point | 299.7ºC at 760mmHg |
| Molecular Formula | C6H4N2O6 |
| Molecular Weight | 200.10600 |
| Flash Point | 135ºC |
| Exact Mass | 200.00700 |
| PSA | 132.10000 |
| LogP | 1.96060 |
| Index of Refraction | 1.712 |
| InChIKey | WQVRLADNOSJVJV-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc([N+](=O)[O-])c(O)c1O |
| HS Code | 2908999090 |
|---|
|
~%
1,2-Benzenediol... CAS#:53816-91-4 |
| Literature: Heertjes et al. Journal of the Chemical Society, 1955 , p. 1313,1315 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1,2-Benzenediol,3,6-dinitro |
| 3,6-Dinitro-1,2-benzenediol |
| 3,6-Dinitro-brenzcatechin |
| 3,6-Dinitropyrocatechol |