3H-inden-1-yl 4-nitrobenzoate structure
|
Common Name | 3H-inden-1-yl 4-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 53820-85-2 | Molecular Weight | 281.26300 | |
| Density | 1.37g/cm3 | Boiling Point | 489.6ºC at 760 mmHg | |
| Molecular Formula | C16H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.6ºC | |
| Name | 3H-inden-1-yl 4-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 489.6ºC at 760 mmHg |
| Molecular Formula | C16H11NO4 |
| Molecular Weight | 281.26300 |
| Flash Point | 223.6ºC |
| Exact Mass | 281.06900 |
| PSA | 72.12000 |
| LogP | 3.87200 |
| Index of Refraction | 1.659 |
| InChIKey | VONKAHOYJCNYBE-UHFFFAOYSA-N |
| SMILES | O=C(OC1=CCc2ccccc21)c1ccc([N+](=O)[O-])cc1 |
|
~%
3H-inden-1-yl 4... CAS#:53820-85-2 |
| Literature: Friedrich,E.C.; Taggart,D.B. Journal of Organic Chemistry, 1975 , vol. 40, # 6 p. 720 - 723 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Inden-3-yl-p-nitrobenzoat |