1-(5-bromo-2-hydroxy-3,4-dimethyl-phenyl)propan-1-one structure
|
Common Name | 1-(5-bromo-2-hydroxy-3,4-dimethyl-phenyl)propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 5384-03-2 | Molecular Weight | 257.12400 | |
| Density | 1.392g/cm3 | Boiling Point | 340.9ºC at 760 mmHg | |
| Molecular Formula | C11H13BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160ºC | |
| Name | 1-(5-bromo-2-hydroxy-3,4-dimethylphenyl)propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.392g/cm3 |
|---|---|
| Boiling Point | 340.9ºC at 760 mmHg |
| Molecular Formula | C11H13BrO2 |
| Molecular Weight | 257.12400 |
| Flash Point | 160ºC |
| Exact Mass | 256.01000 |
| PSA | 37.30000 |
| LogP | 3.36420 |
| Index of Refraction | 1.564 |
| InChIKey | LTINARLTQHMYIB-UHFFFAOYSA-N |
| SMILES | CCC(=O)c1cc(Br)c(C)c(C)c1O |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1-(5-BROMO-2-HYDROXY-3,4-DIMETHYL-PHENYL)PROPAN-1-ONE |
| Propiophenone,5'-bromo-2'-hydroxy-3',4'-dimethyl |
| Propiophenone,5-bromo-3,4-dimethyl-2-hydroxy |