N-[(2,4-dichlorophenyl)methyl]-3-(furan-2-yl)prop-2-enamide
Modify Date: 2024-04-07 10:20:44
![N-[(2,4-dichlorophenyl)methyl]-3-(furan-2-yl)prop-2-enamide Structure](https://image.chemsrc.com/caspic/208/5384-58-7.png)
N-[(2,4-dichlorophenyl)methyl]-3-(furan-2-yl)prop-2-enamide structure
|
Common Name | N-[(2,4-dichlorophenyl)methyl]-3-(furan-2-yl)prop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 5384-58-7 | Molecular Weight | 296.14900 | |
| Density | 1.344g/cm3 | Boiling Point | 495ºC at 760 mmHg | |
| Molecular Formula | C14H11Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.2ºC | |
| Name | N-[(2,4-dichlorophenyl)methyl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.344g/cm3 |
|---|---|
| Boiling Point | 495ºC at 760 mmHg |
| Molecular Formula | C14H11Cl2NO2 |
| Molecular Weight | 296.14900 |
| Flash Point | 253.2ºC |
| Exact Mass | 295.01700 |
| PSA | 45.73000 |
| LogP | 4.75630 |
| Index of Refraction | 1.616 |
| InChIKey | CDSPWCDVUFPEOJ-UHFFFAOYSA-N |
| SMILES | O=C(C=Cc1ccco1)NCc1ccc(Cl)cc1Cl |
| HS Code | 2915509000 |
|---|
| HS Code | 2915509000 |
|---|---|
| Summary | 2915509000 propionic acid, its salts and esters。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| n-[(2,4-dichlorophenyl)methyl]-3-(2-furyl)prop-2-enamide |