3-chloro-2-hydroxy-5-nitrobenzaldehyde structure
|
Common Name | 3-chloro-2-hydroxy-5-nitrobenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 53844-96-5 | Molecular Weight | 201.56400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H4ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-chloro-2-hydroxy-5-nitrobenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H4ClNO4 |
|---|---|
| Molecular Weight | 201.56400 |
| Exact Mass | 200.98300 |
| PSA | 83.12000 |
| LogP | 2.28950 |
| InChIKey | CXAJGDMXKZJHBG-UHFFFAOYSA-N |
| SMILES | O=Cc1cc([N+](=O)[O-])cc(Cl)c1O |
|
~%
3-chloro-2-hydr... CAS#:53844-96-5 |
| Literature: Davies; Rubenstein Journal of the Chemical Society, 1923 , vol. 123, p. 2850 |
|
~%
3-chloro-2-hydr... CAS#:53844-96-5 |
| Literature: Davies; Rubenstein Journal of the Chemical Society, 1923 , vol. 123, p. 2850 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 5-Chlor-3-nitro-salicylaldehyd |
| 3-chloro-2-hydroxy-5-nitro-benzaldehyde |
| 3-Chlor-5-nitro-salicylaldehyd |
| Benzaldehyde,3-chloro-2-hydroxy-5-nitro |
| 3-chloro-5-nitrosalicylaldehyde |
| 3-Chlor-2-hydroxy-5-nitro-benzaldehyd |