dinopenton structure
|
Common Name | dinopenton | ||
|---|---|---|---|---|
| CAS Number | 5386-57-2 | Molecular Weight | 340.32900 | |
| Density | 1.243g/cm3 | Boiling Point | 432.6ºC at 760mmHg | |
| Molecular Formula | C15H20N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.1ºC | |
| Name | dinopenton |
|---|---|
| Synonym | More Synonyms |
| Density | 1.243g/cm3 |
|---|---|
| Boiling Point | 432.6ºC at 760mmHg |
| Molecular Formula | C15H20N2O7 |
| Molecular Weight | 340.32900 |
| Flash Point | 164.1ºC |
| Exact Mass | 340.12700 |
| PSA | 127.17000 |
| LogP | 5.37680 |
| Index of Refraction | 1.534 |
| InChIKey | QQHRSBLQLJPBPJ-UHFFFAOYSA-N |
| SMILES | CCCC(C)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1OC(=O)OC(C)C |
| HS Code | 2920909090 |
|---|
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Dinopenton |
| rac-2,4-dinitro-6-[(2R)-pentan-2-yl]phenyl propan-2-yl carbonate |
| Dinopenton [ISO] |
| (2,4-dinitro-6-pentan-2-ylphenyl) propan-2-yl carbonate |
| isopropyl (RS)-2-(1-methylbutyl)-4,6-dinitrophenyl carbonate |
| 2-(1-methylbutyl)-4,6-dinitrophenyl 1-methylethyl carbonate |
| Carbonic acid,2-(1-methylbutyl)-4,6-dinitrophenyl 1-methylethyl ester |