4-cinnamoyloxyphenylurea
Modify Date: 2025-10-04 08:35:15
4-cinnamoyloxyphenylurea structure
|
Common Name | 4-cinnamoyloxyphenylurea | ||
|---|---|---|---|---|
| CAS Number | 539-09-3 | Molecular Weight | 282.29400 | |
| Density | 1.305g/cm3 | Boiling Point | 471.2ºC at 760mmHg | |
| Molecular Formula | C16H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.8ºC | |
| Name | [4-(carbamoylamino)phenyl] 3-phenylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.305g/cm3 |
|---|---|
| Boiling Point | 471.2ºC at 760mmHg |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.29400 |
| Flash Point | 238.8ºC |
| Exact Mass | 282.10000 |
| PSA | 82.41000 |
| LogP | 3.38280 |
| Index of Refraction | 1.678 |
| InChIKey | YVPVJILEKSSIKI-IZZDOVSWSA-N |
| SMILES | NC(=O)Nc1ccc(OC(=O)C=Cc2ccccc2)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
4-cinnamoyloxyp... CAS#:539-09-3 |
| Literature: Ges.f.chem.Ind.Basel Patent: DE224107 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 10, p. 1107 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (4-Cinnamoyloxy-phenyl)-harnstoff |
| Cinnamicacid,ester with (p-hydroxyphenyl)urea (8CI) |
| 2-Propenoic acid,3-phenyl-,4-[(aminocarbonyl)amino]phenyl ester |
| Cinnamic acid,p-ureidophenylester (6CI) |
| O-Cinnamoyl-p-hydroxyphenylurea |
| Cinnapyrine |
| Urea,(p-hydroxyphenyl)-,cinnamate (8CI) |
| 4-Cinnamoyloxyphenylurea |
| Elbon |