[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] 2-(furan-2-carbonylamino)benzoate structure
|
Common Name | [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] 2-(furan-2-carbonylamino)benzoate | ||
|---|---|---|---|---|
| CAS Number | 5390-56-7 | Molecular Weight | 466.79400 | |
| Density | 1.496g/cm3 | Boiling Point | 567.6ºC at 760mmHg | |
| Molecular Formula | C21H14ClF3N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 297.1ºC | |
| Name | [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] 2-(furan-2-carbonylamino)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.496g/cm3 |
|---|---|
| Boiling Point | 567.6ºC at 760mmHg |
| Molecular Formula | C21H14ClF3N2O5 |
| Molecular Weight | 466.79400 |
| Flash Point | 297.1ºC |
| Exact Mass | 466.05400 |
| PSA | 101.13000 |
| LogP | 5.72210 |
| Index of Refraction | 1.613 |
| InChIKey | OMGNNUKSULEHOY-UHFFFAOYSA-N |
| SMILES | O=C(COC(=O)c1ccccc1NC(=O)c1ccco1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
|
~%
[2-[4-chloro-3-... CAS#:5390-56-7 |
| Literature: Marans; Zelinski Journal of the American Chemical Society, 1950 , vol. 72, p. 2125 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| trans-crotonic acid-(2-nitro-butyl ester) |
| T0515-9567 |
| trans-Crotonsaeure-(2-nitro-butylester) |